C17H16N6O — CID 71727536
1,3-bis(1H-benzimidazol-2-ylmethyl)urea (PubChem CID 71727536) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 1,3-bis(1H-benzimidazol-2-ylmethyl)urea.
| Compound Name | 1,3-bis(1H-benzimidazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 71727536 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1,3-bis(1H-benzimidazol-2-ylmethyl)urea |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H16N6O/c24-17(18-9-15-20-11-5-1-2-6-12(11)21-15)19-10-16-22-13-7-3-4-8-14(13)23-16/h1-8H,9-10H2,(H,20,21)(H,22,23)(H2,18,19,24) |
| InChIKey | LJBNBKSCXAYOKX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |