C13H18Cl3NO — CID 71727754
2-(3,4-dichlorophenyl)-2-piperidin-4-ylethanol;hydrochloride (PubChem CID 71727754) has the molecular formula C13H18Cl3NO and a molecular weight of 310.65 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-piperidin-4-ylethanol;hydrochloride.
| Compound Name | 2-(3,4-dichlorophenyl)-2-piperidin-4-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 71727754 |
| Molecular Formula | C13H18Cl3NO |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-piperidin-4-ylethanol;hydrochloride |
| SMILES | Cl.OCC(c1ccc(Cl)c(Cl)c1)C1CCNCC1 |
| InChI | InChI=1S/C13H17Cl2NO.ClH/c14-12-2-1-10(7-13(12)15)11(8-17)9-3-5-16-6-4-9;/h1-2,7,9,11,16-17H,3-6,8H2;1H |
| InChIKey | UMJOPAHCVSNVNC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |