C13H17Cl2NO — CID 16719669
(2R)-2-(3,4-dichlorophenyl)-2-[(2R)-piperidin-2-yl]ethanol (PubChem CID 16719669) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is (2R)-2-(3,4-dichlorophenyl)-2-[(2R)-piperidin-2-yl]ethanol.
| Compound Name | (2R)-2-(3,4-dichlorophenyl)-2-[(2R)-piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 16719669 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (2R)-2-(3,4-dichlorophenyl)-2-[(2R)-piperidin-2-yl]ethanol |
| SMILES | OC[C@H](c1ccc(Cl)c(Cl)c1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C13H17Cl2NO/c14-11-5-4-9(7-12(11)15)10(8-17)13-3-1-2-6-16-13/h4-5,7,10,13,16-17H,1-3,6,8H2/t10-,13-/m1/s1 |
| InChIKey | VBLILHAGVIRWHD-ZWNOBZJWSA-N |
| XLogP | 3.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |