About 4-diethoxyphosphoryloxybutyl 2-propylpentanoate
4-diethoxyphosphoryloxybutyl 2-propylpentanoate (PubChem CID 71728027) has the molecular formula C16H33O6P
and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-diethoxyphosphoryloxybutyl 2-propylpentanoate.
Molecular Properties
| Compound Name | 4-diethoxyphosphoryloxybutyl 2-propylpentanoate |
| PubChem CID | 71728027 |
| Molecular Formula | C16H33O6P |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 4-diethoxyphosphoryloxybutyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCCCCOP(=O)(OCC)OCC |
| InChI | InChI=1S/C16H33O6P/c1-5-11-15(12-6-2)16(17)19-13-9-10-14-22-23(18,20-7-3)21-8-4/h15H,5-14H2,1-4H3 |
| InChIKey | PEKKMHHWYQHHNK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-diethoxyphosphoryloxybutyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diethoxyphosphoryloxybutyl 2-propylpentanoate?
The IUPAC name of 4-diethoxyphosphoryloxybutyl 2-propylpentanoate (CID 71728027) is 4-diethoxyphosphoryloxybutyl 2-propylpentanoate.
What is the SMILES notation for 4-diethoxyphosphoryloxybutyl 2-propylpentanoate?
The canonical SMILES for 4-diethoxyphosphoryloxybutyl 2-propylpentanoate is CCCC(CCC)C(=O)OCCCCOP(=O)(OCC)OCC.
What is the InChIKey of 4-diethoxyphosphoryloxybutyl 2-propylpentanoate?
The InChIKey is PEKKMHHWYQHHNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33O6P/c1-5-11-15(12-6-2)16(17)19-13-9-10-14-22-23(18,20-7-3)21-8-4/h15H,5-14H2,1-4H3.
What are the key properties of 4-diethoxyphosphoryloxybutyl 2-propylpentanoate?
4-diethoxyphosphoryloxybutyl 2-propylpentanoate has a molecular weight of 352.41 g/mol, XLogP of 4.72, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diethoxyphosphoryloxybutyl 2-propylpentanoate is sourced from PubChem (CID 71728027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).