C24H31N3O2S — CID 7173088
(2R)-2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 7173088) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is (2R)-2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | (2R)-2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 7173088 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2R)-2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | CCCCCCn1c(S[C@H](C)C(=O)NCc2ccc(OC)cc2)nc2ccccc21 |
| InChI | InChI=1S/C24H31N3O2S/c1-4-5-6-9-16-27-22-11-8-7-10-21(22)26-24(27)30-18(2)23(28)25-17-19-12-14-20(29-3)15-13-19/h7-8,10-15,18H,4-6,9,16-17H2,1-3H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | MLMLDBLCSMYIEX-GOSISDBHSA-N |
| XLogP | 5.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|