C13H24O3Si — CID 71732672
tert-butyl 2-(trimethylsilylmethyl)buta-2,3-dienyl carbonate (PubChem CID 71732672) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is tert-butyl 2-(trimethylsilylmethyl)buta-2,3-dienyl carbonate.
| Compound Name | tert-butyl 2-(trimethylsilylmethyl)buta-2,3-dienyl carbonate |
|---|---|
| PubChem CID | 71732672 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | tert-butyl 2-(trimethylsilylmethyl)buta-2,3-dienyl carbonate |
| SMILES | C=C=C(COC(=O)OC(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C13H24O3Si/c1-8-11(10-17(5,6)7)9-15-12(14)16-13(2,3)4/h1,9-10H2,2-7H3 |
| InChIKey | PSISDGNSTDMCIL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|