C28H47NO3SSi — CID 71734992
(NE)-4-methyl-N-[2-[1-tri(propan-2-yl)silyloxyheptyl]cyclopent-2-en-1-ylidene]benzenesulfonamide (PubChem CID 71734992) has the molecular formula C28H47NO3SSi and a molecular weight of 505.84 g/mol. Its IUPAC name is (NE)-4-methyl-N-[2-[1-tri(propan-2-yl)silyloxyheptyl]cyclopent-2-en-1-ylidene]benzenesulfonamide.
| Compound Name | (NE)-4-methyl-N-[2-[1-tri(propan-2-yl)silyloxyheptyl]cyclopent-2-en-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 71734992 |
| Molecular Formula | C28H47NO3SSi |
| Molecular Weight | 505.84 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | (NE)-4-methyl-N-[2-[1-tri(propan-2-yl)silyloxyheptyl]cyclopent-2-en-1-ylidene]benzenesulfonamide |
| SMILES | CCCCCCC(O[Si](C(C)C)(C(C)C)C(C)C)C1=CCC/C1=N\S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H47NO3SSi/c1-9-10-11-12-16-28(32-34(21(2)3,22(4)5)23(6)7)26-14-13-15-27(26)29-33(30,31)25-19-17-24(8)18-20-25/h14,17-23,28H,9-13,15-16H2,1-8H3/b29-27+ |
| InChIKey | HVJIULYHENLOPV-ORIPQNMZSA-N |
| XLogP | 8.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.84 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|