About 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol
1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol (PubChem CID 71737151) has the molecular formula C21H18N2O2
and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol |
| PubChem CID | 71737151 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol |
| SMILES | Cc1ccc(-c2cnco2)cc1NCc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C21H18N2O2/c1-14-6-7-16(21-12-22-13-25-21)10-19(14)23-11-18-17-5-3-2-4-15(17)8-9-20(18)24/h2-10,12-13,23-24H,11H2,1H3 |
| InChIKey | BMRSXGGHJVMMLB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol?
The IUPAC name of 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol (CID 71737151) is 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol.
What is the SMILES notation for 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol?
The canonical SMILES for 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol is Cc1ccc(-c2cnco2)cc1NCc1c(O)ccc2ccccc12.
What is the InChIKey of 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol?
The InChIKey is BMRSXGGHJVMMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2/c1-14-6-7-16(21-12-22-13-25-21)10-19(14)23-11-18-17-5-3-2-4-15(17)8-9-20(18)24/h2-10,12-13,23-24H,11H2,1H3.
What are the key properties of 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol?
1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol has a molecular weight of 330.39 g/mol, XLogP of 5.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-methyl-5-(1,3-oxazol-5-yl)anilino]methyl]naphthalen-2-ol is sourced from PubChem (CID 71737151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).