C19H17F3O3S2 — CID 71737438
ethyl 2-[4-[2-sulfanyl-2-[4-(trifluoromethyl)phenyl]ethanethioyl]phenoxy]acetate (PubChem CID 71737438) has the molecular formula C19H17F3O3S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is ethyl 2-[4-[2-sulfanyl-2-[4-(trifluoromethyl)phenyl]ethanethioyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-sulfanyl-2-[4-(trifluoromethyl)phenyl]ethanethioyl]phenoxy]acetate |
|---|---|
| PubChem CID | 71737438 |
| Molecular Formula | C19H17F3O3S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | ethyl 2-[4-[2-sulfanyl-2-[4-(trifluoromethyl)phenyl]ethanethioyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=S)C(S)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H17F3O3S2/c1-2-24-16(23)11-25-15-9-5-13(6-10-15)18(27)17(26)12-3-7-14(8-4-12)19(20,21)22/h3-10,17,26H,2,11H2,1H3 |
| InChIKey | JASAXRLCXSVPLC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|