C27H24FN3O3S — CID 71737938
N-[3-[[3-(6-fluoro-1,2-benzoxazol-3-yl)propylamino]methyl]phenyl]naphthalene-1-sulfonamide (PubChem CID 71737938) has the molecular formula C27H24FN3O3S and a molecular weight of 489.57 g/mol. Its IUPAC name is N-[3-[[3-(6-fluoro-1,2-benzoxazol-3-yl)propylamino]methyl]phenyl]naphthalene-1-sulfonamide.
| Compound Name | N-[3-[[3-(6-fluoro-1,2-benzoxazol-3-yl)propylamino]methyl]phenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 71737938 |
| Molecular Formula | C27H24FN3O3S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-[3-[[3-(6-fluoro-1,2-benzoxazol-3-yl)propylamino]methyl]phenyl]naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CNCCCc2noc3cc(F)ccc23)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H24FN3O3S/c28-21-13-14-24-25(30-34-26(24)17-21)11-5-15-29-18-19-6-3-9-22(16-19)31-35(32,33)27-12-4-8-20-7-1-2-10-23(20)27/h1-4,6-10,12-14,16-17,29,31H,5,11,15,18H2 |
| InChIKey | SCCKPELKQSODEG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|