C26H25FN2O3S — CID 71738589
N-[3-[[3-(3-fluorophenoxy)propylamino]methyl]phenyl]naphthalene-2-sulfonamide (PubChem CID 71738589) has the molecular formula C26H25FN2O3S and a molecular weight of 464.56 g/mol. Its IUPAC name is N-[3-[[3-(3-fluorophenoxy)propylamino]methyl]phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-[[3-(3-fluorophenoxy)propylamino]methyl]phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 71738589 |
| Molecular Formula | C26H25FN2O3S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[3-[[3-(3-fluorophenoxy)propylamino]methyl]phenyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CNCCCOc2cccc(F)c2)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H25FN2O3S/c27-23-9-4-11-25(18-23)32-15-5-14-28-19-20-6-3-10-24(16-20)29-33(30,31)26-13-12-21-7-1-2-8-22(21)17-26/h1-4,6-13,16-18,28-29H,5,14-15,19H2 |
| InChIKey | NGXKTQKLIZPCHZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|