C26H26N2O4S — CID 71738661
N-[3-[[2-(3-methoxyphenoxy)ethylamino]methyl]phenyl]naphthalene-2-sulfonamide (PubChem CID 71738661) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[3-[[2-(3-methoxyphenoxy)ethylamino]methyl]phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-[[2-(3-methoxyphenoxy)ethylamino]methyl]phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 71738661 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[3-[[2-(3-methoxyphenoxy)ethylamino]methyl]phenyl]naphthalene-2-sulfonamide |
| SMILES | COc1cccc(OCCNCc2cccc(NS(=O)(=O)c3ccc4ccccc4c3)c2)c1 |
| InChI | InChI=1S/C26H26N2O4S/c1-31-24-10-5-11-25(18-24)32-15-14-27-19-20-6-4-9-23(16-20)28-33(29,30)26-13-12-21-7-2-3-8-22(21)17-26/h2-13,16-18,27-28H,14-15,19H2,1H3 |
| InChIKey | KTGFUFPNPCINGN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|