C12H24N2O — CID 71741912
4-N-(1-methylcyclohexyl)oxane-3,4-diamine (PubChem CID 71741912) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-N-(1-methylcyclohexyl)oxane-3,4-diamine.
| Compound Name | 4-N-(1-methylcyclohexyl)oxane-3,4-diamine |
|---|---|
| PubChem CID | 71741912 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 4-N-(1-methylcyclohexyl)oxane-3,4-diamine |
| SMILES | CC1(NC2CCOCC2N)CCCCC1 |
| InChI | InChI=1S/C12H24N2O/c1-12(6-3-2-4-7-12)14-11-5-8-15-9-10(11)13/h10-11,14H,2-9,13H2,1H3 |
| InChIKey | UGIKJLOXFBHPJV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |