C9H12N3O4- — CID 7174454
1-methyl-3-(2-methylpropyl)-4-nitropyrazole-5-carboxylate (PubChem CID 7174454) has the molecular formula C9H12N3O4- and a molecular weight of 226.21 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpropyl)-4-nitropyrazole-5-carboxylate.
| Compound Name | 1-methyl-3-(2-methylpropyl)-4-nitropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 7174454 |
| Molecular Formula | C9H12N3O4- |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-methyl-3-(2-methylpropyl)-4-nitropyrazole-5-carboxylate |
| SMILES | CC(C)Cc1nn(C)c(C(=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O4/c1-5(2)4-6-7(12(15)16)8(9(13)14)11(3)10-6/h5H,4H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | GIYYGHMYUNYGKY-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 101.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|