C12H18N4O5 — CID 119361152
(2S)-2-[(1,3-dimethyl-4-nitropyrazole-5-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119361152) has the molecular formula C12H18N4O5 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2S)-2-[(1,3-dimethyl-4-nitropyrazole-5-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(1,3-dimethyl-4-nitropyrazole-5-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119361152 |
| Molecular Formula | C12H18N4O5 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2S)-2-[(1,3-dimethyl-4-nitropyrazole-5-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1nn(C)c(C(=O)N[C@@H](CC(C)C)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O5/c1-6(2)5-8(12(18)19)13-11(17)10-9(16(20)21)7(3)14-15(10)4/h6,8H,5H2,1-4H3,(H,13,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | AFOMGZDJQXKCAR-QMMMGPOBSA-N |
| XLogP | 0.87 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|