C11H17N3O4 — CID 104571810
2-(1,3-dimethyl-4-nitropyrazol-5-yl)-4-methylpentanoic acid (PubChem CID 104571810) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-(1,3-dimethyl-4-nitropyrazol-5-yl)-4-methylpentanoic acid.
| Compound Name | 2-(1,3-dimethyl-4-nitropyrazol-5-yl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 104571810 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-(1,3-dimethyl-4-nitropyrazol-5-yl)-4-methylpentanoic acid |
| SMILES | Cc1nn(C)c(C(CC(C)C)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O4/c1-6(2)5-8(11(15)16)10-9(14(17)18)7(3)12-13(10)4/h6,8H,5H2,1-4H3,(H,15,16) |
| InChIKey | YCPNRQUCEIZCOD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|