C13H24N4O2 — CID 63198351
3-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-ethyl-4-methylpentan-2-amine (PubChem CID 63198351) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-ethyl-4-methylpentan-2-amine.
| Compound Name | 3-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-ethyl-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 63198351 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-ethyl-4-methylpentan-2-amine |
| SMILES | CCNC(C)C(c1c([N+](=O)[O-])c(C)nn1C)C(C)C |
| InChI | InChI=1S/C13H24N4O2/c1-7-14-9(4)11(8(2)3)13-12(17(18)19)10(5)15-16(13)6/h8-9,11,14H,7H2,1-6H3 |
| InChIKey | VWXJCTJXWIMHLH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|