C10H17N3O3 — CID 63201638
3-(1,3-dimethyl-4-nitropyrazol-5-yl)pentan-2-ol (PubChem CID 63201638) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-(1,3-dimethyl-4-nitropyrazol-5-yl)pentan-2-ol.
| Compound Name | 3-(1,3-dimethyl-4-nitropyrazol-5-yl)pentan-2-ol |
|---|---|
| PubChem CID | 63201638 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-(1,3-dimethyl-4-nitropyrazol-5-yl)pentan-2-ol |
| SMILES | CCC(c1c([N+](=O)[O-])c(C)nn1C)C(C)O |
| InChI | InChI=1S/C10H17N3O3/c1-5-8(7(3)14)10-9(13(15)16)6(2)11-12(10)4/h7-8,14H,5H2,1-4H3 |
| InChIKey | YHENEOZMTCMACG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|