C9H15N3O3S — CID 103704751
3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-ol (PubChem CID 103704751) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-ol.
| Compound Name | 3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 103704751 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-ol |
| SMILES | Cc1nn(C)c(SC(C)C(C)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H15N3O3S/c1-5-8(12(14)15)9(11(4)10-5)16-7(3)6(2)13/h6-7,13H,1-4H3 |
| InChIKey | WICQOILVCYDPOB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|