C9H13N3O3S — CID 95974548
(3S)-3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-one (PubChem CID 95974548) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is (3S)-3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-one.
| Compound Name | (3S)-3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-one |
|---|---|
| PubChem CID | 95974548 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3S)-3-(1,3-dimethyl-4-nitropyrazol-5-yl)sulfanylbutan-2-one |
| SMILES | CC(=O)[C@H](C)Sc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C9H13N3O3S/c1-5-8(12(14)15)9(11(4)10-5)16-7(3)6(2)13/h7H,1-4H3/t7-/m0/s1 |
| InChIKey | DYUHKLBHTFWRRL-ZETCQYMHSA-N |
| XLogP | 1.71 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|