C16H17FN4O4 — CID 97331216
N-[(2S)-4-(4-fluorophenyl)-4-oxobutan-2-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 97331216) has the molecular formula C16H17FN4O4 and a molecular weight of 348.33 g/mol. Its IUPAC name is N-[(2S)-4-(4-fluorophenyl)-4-oxobutan-2-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[(2S)-4-(4-fluorophenyl)-4-oxobutan-2-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 97331216 |
| Molecular Formula | C16H17FN4O4 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[(2S)-4-(4-fluorophenyl)-4-oxobutan-2-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)N[C@@H](C)CC(=O)c2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17FN4O4/c1-9(8-13(22)11-4-6-12(17)7-5-11)18-16(23)15-14(21(24)25)10(2)19-20(15)3/h4-7,9H,8H2,1-3H3,(H,18,23)/t9-/m0/s1 |
| InChIKey | AMGJZAQZXXCOLF-VIFPVBQESA-N |
| XLogP | 2.17 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|