C16H20N4O3S — CID 129399358
1,3-dimethyl-N-[(2S)-1-(4-methylphenyl)sulfanylpropan-2-yl]-4-nitropyrazole-5-carboxamide (PubChem CID 129399358) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 1,3-dimethyl-N-[(2S)-1-(4-methylphenyl)sulfanylpropan-2-yl]-4-nitropyrazole-5-carboxamide.
| Compound Name | 1,3-dimethyl-N-[(2S)-1-(4-methylphenyl)sulfanylpropan-2-yl]-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 129399358 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1,3-dimethyl-N-[(2S)-1-(4-methylphenyl)sulfanylpropan-2-yl]-4-nitropyrazole-5-carboxamide |
| SMILES | Cc1ccc(SC[C@H](C)NC(=O)c2c([N+](=O)[O-])c(C)nn2C)cc1 |
| InChI | InChI=1S/C16H20N4O3S/c1-10-5-7-13(8-6-10)24-9-11(2)17-16(21)15-14(20(22)23)12(3)18-19(15)4/h5-8,11H,9H2,1-4H3,(H,17,21)/t11-/m0/s1 |
| InChIKey | CZNXYZYSDDQCHW-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|