C16H16N2O4 — CID 71744956
methyl (Z)-3-(3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitrophenyl)prop-2-enoate (PubChem CID 71744956) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl (Z)-3-(3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitrophenyl)prop-2-enoate.
| Compound Name | methyl (Z)-3-(3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71744956 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl (Z)-3-(3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitrophenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1[nH]c(C)cc1C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N2O4/c1-10-8-11(2)17-14(10)9-13(16(19)22-3)12-6-4-5-7-15(12)18(20)21/h4-9,17H,1-3H3/b13-9- |
| InChIKey | XAYWFRRNISSFJW-LCYFTJDESA-N |
| XLogP | 3.25 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|