C30H31N5O9S — CID 71745870
ethyl 5,7-dimethyl-3-[2-(methylsulfamoyl)phenyl]-4-oxo-2-[2-(pyridine-2-carbonyloxy)ethylcarbamoyloxymethyl]quinazoline-6-carboxylate (PubChem CID 71745870) has the molecular formula C30H31N5O9S and a molecular weight of 637.67 g/mol. Its IUPAC name is ethyl 5,7-dimethyl-3-[2-(methylsulfamoyl)phenyl]-4-oxo-2-[2-(pyridine-2-carbonyloxy)ethylcarbamoyloxymethyl]quinazoline-6-carboxylate.
| Compound Name | ethyl 5,7-dimethyl-3-[2-(methylsulfamoyl)phenyl]-4-oxo-2-[2-(pyridine-2-carbonyloxy)ethylcarbamoyloxymethyl]quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 71745870 |
| Molecular Formula | C30H31N5O9S |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | ethyl 5,7-dimethyl-3-[2-(methylsulfamoyl)phenyl]-4-oxo-2-[2-(pyridine-2-carbonyloxy)ethylcarbamoyloxymethyl]quinazoline-6-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2nc(COC(=O)NCCOC(=O)c3ccccn3)n(-c3ccccc3S(=O)(=O)NC)c(=O)c2c1C |
| InChI | InChI=1S/C30H31N5O9S/c1-5-42-29(38)25-18(2)16-21-26(19(25)3)27(36)35(22-11-6-7-12-23(22)45(40,41)31-4)24(34-21)17-44-30(39)33-14-15-43-28(37)20-10-8-9-13-32-20/h6-13,16,31H,5,14-15,17H2,1-4H3,(H,33,39) |
| InChIKey | JIAJSAIEWRZNLB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 184.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|