C24H27N3O4 — CID 7174749
(5S)-1,3,8,8-tetramethyl-5-(2-prop-2-enoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 7174749) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (5S)-1,3,8,8-tetramethyl-5-(2-prop-2-enoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | (5S)-1,3,8,8-tetramethyl-5-(2-prop-2-enoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 7174749 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (5S)-1,3,8,8-tetramethyl-5-(2-prop-2-enoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | C=CCOc1ccccc1[C@H]1C2=C(CC(C)(C)CC2=O)Nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C24H27N3O4/c1-6-11-31-17-10-8-7-9-14(17)18-19-15(12-24(2,3)13-16(19)28)25-21-20(18)22(29)27(5)23(30)26(21)4/h6-10,18,25H,1,11-13H2,2-5H3/t18-/m0/s1 |
| InChIKey | ZFRADEHVPXXWKF-SFHVURJKSA-N |
| XLogP | 2.85 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|