C25H22Cl2N4O5S — CID 71748123
5-chloro-3-[(2S)-2-[[4-(2-chloro-4-pyridinyl)phenoxy]methyl]morpholin-4-yl]sulfonyl-1H-indole-2-carboxamide (PubChem CID 71748123) has the molecular formula C25H22Cl2N4O5S and a molecular weight of 561.45 g/mol. Its IUPAC name is 5-chloro-3-[(2S)-2-[[4-(2-chloro-4-pyridinyl)phenoxy]methyl]morpholin-4-yl]sulfonyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(2S)-2-[[4-(2-chloro-4-pyridinyl)phenoxy]methyl]morpholin-4-yl]sulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71748123 |
| Molecular Formula | C25H22Cl2N4O5S |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 5-chloro-3-[(2S)-2-[[4-(2-chloro-4-pyridinyl)phenoxy]methyl]morpholin-4-yl]sulfonyl-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(Cl)cc2c1S(=O)(=O)N1CCO[C@H](COc2ccc(-c3ccnc(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C25H22Cl2N4O5S/c26-17-3-6-21-20(12-17)24(23(30-21)25(28)32)37(33,34)31-9-10-35-19(13-31)14-36-18-4-1-15(2-5-18)16-7-8-29-22(27)11-16/h1-8,11-12,19,30H,9-10,13-14H2,(H2,28,32)/t19-/m0/s1 |
| InChIKey | ZEFCVMQQOISDEN-IBGZPJMESA-N |
| XLogP | 4.10 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|