C8H8F3N3O5 — CID 71749878
2-(2,5-dioxopyrrol-1-yl)acetohydrazide;2,2,2-trifluoroacetic acid (PubChem CID 71749878) has the molecular formula C8H8F3N3O5 and a molecular weight of 283.16 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)acetohydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)acetohydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71749878 |
| Molecular Formula | C8H8F3N3O5 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)acetohydrazide;2,2,2-trifluoroacetic acid |
| SMILES | NNC(=O)CN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H7N3O3.C2HF3O2/c7-8-4(10)3-9-5(11)1-2-6(9)12;3-2(4,5)1(6)7/h1-2H,3,7H2,(H,8,10);(H,6,7) |
| InChIKey | VKLHIUBGLCUQBN-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|