C21H19ClN2O3S — CID 7175294
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(4-methylquinolin-2-yl)sulfanylacetate (PubChem CID 7175294) has the molecular formula C21H19ClN2O3S and a molecular weight of 414.91 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(4-methylquinolin-2-yl)sulfanylacetate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(4-methylquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7175294 |
| Molecular Formula | C21H19ClN2O3S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(4-methylquinolin-2-yl)sulfanylacetate |
| SMILES | Cc1cc(SCC(=O)OCC(=O)NCc2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H19ClN2O3S/c1-14-10-20(24-18-5-3-2-4-17(14)18)28-13-21(26)27-12-19(25)23-11-15-6-8-16(22)9-7-15/h2-10H,11-13H2,1H3,(H,23,25) |
| InChIKey | GLXAPNSJOOQBRS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |