C15H22O6 — CID 71753459
ethyl 3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]heptanoate (PubChem CID 71753459) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]heptanoate.
| Compound Name | ethyl 3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]heptanoate |
|---|---|
| PubChem CID | 71753459 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]heptanoate |
| SMILES | CCCCC(CC(=O)OCC)c1oc(CO)cc(=O)c1O |
| InChI | InChI=1S/C15H22O6/c1-3-5-6-10(7-13(18)20-4-2)15-14(19)12(17)8-11(9-16)21-15/h8,10,16,19H,3-7,9H2,1-2H3 |
| InChIKey | FAUIRPXLEJCMSR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |