C7H10N2O — CID 71755629
3-amino-1,4-dimethylpyridin-2-one (PubChem CID 71755629) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-amino-1,4-dimethylpyridin-2-one.
| Compound Name | 3-amino-1,4-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 71755629 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-amino-1,4-dimethylpyridin-2-one |
| SMILES | Cc1ccn(C)c(=O)c1N |
| InChI | InChI=1S/C7H10N2O/c1-5-3-4-9(2)7(10)6(5)8/h3-4H,8H2,1-2H3 |
| InChIKey | MWKCQKVQIOJRKS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |