C10H11F3N2O — CID 176689740
(3E)-4-ethyl-3-(1,1,1-trifluorobut-3-en-2-ylidene)-1H-pyrazin-2-one (PubChem CID 176689740) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is (3E)-4-ethyl-3-(1,1,1-trifluorobut-3-en-2-ylidene)-1H-pyrazin-2-one.
| Compound Name | (3E)-4-ethyl-3-(1,1,1-trifluorobut-3-en-2-ylidene)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 176689740 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (3E)-4-ethyl-3-(1,1,1-trifluorobut-3-en-2-ylidene)-1H-pyrazin-2-one |
| SMILES | C=C/C(=C1/C(=O)NC=CN1CC)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O/c1-3-7(10(11,12)13)8-9(16)14-5-6-15(8)4-2/h3,5-6H,1,4H2,2H3,(H,14,16)/b8-7+ |
| InChIKey | IWSOKSURMTYQTR-BQYQJAHWSA-N |
| XLogP | 1.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|