C8H9F3N2O — CID 84008555
3-Amino-1-ethyl-5-(trifluoromethyl)pyridin-2-one (PubChem CID 84008555) has the molecular formula C8H9F3N2O and a molecular weight of 206.16 g/mol. Its IUPAC name is 3-amino-1-ethyl-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-Amino-1-ethyl-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 84008555 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-amino-1-ethyl-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CCN1C=C(C=C(C1=O)N)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O/c1-2-13-4-5(8(9,10)11)3-6(12)7(13)14/h3-4H,2,12H2,1H3 |
| InChIKey | QGXNVFKAEFBQGI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 317 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |