About 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid
4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid (PubChem CID 71756113) has the molecular formula C5H4N2O4S
and a molecular weight of 188.16 g/mol. Its IUPAC name is 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid.
Analyze 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid?
The IUPAC name of 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid (CID 71756113) is 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid.
What is the SMILES notation for 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid?
The canonical SMILES for 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid is COC(=O)c1nsnc1C(=O)O.
What is the InChIKey of 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid?
The InChIKey is MFGBLEMSPVIAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O4S/c1-11-5(10)3-2(4(8)9)6-12-7-3/h1H3,(H,8,9).
What are the key properties of 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid?
4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid has a molecular weight of 188.16 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycarbonyl-1,2,5-thiadiazole-3-carboxylic acid is sourced from PubChem (CID 71756113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).