C7H13Cl2N3 — CID 71757614
3-(chloromethyl)-5-methyl-4-propyl-1,2,4-triazole;hydrochloride (PubChem CID 71757614) has the molecular formula C7H13Cl2N3 and a molecular weight of 210.11 g/mol. Its IUPAC name is 3-(chloromethyl)-5-methyl-4-propyl-1,2,4-triazole;hydrochloride.
| Compound Name | 3-(chloromethyl)-5-methyl-4-propyl-1,2,4-triazole;hydrochloride |
|---|---|
| PubChem CID | 71757614 |
| Molecular Formula | C7H13Cl2N3 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-(chloromethyl)-5-methyl-4-propyl-1,2,4-triazole;hydrochloride |
| SMILES | CCCn1c(C)nnc1CCl.Cl |
| InChI | InChI=1S/C7H12ClN3.ClH/c1-3-4-11-6(2)9-10-7(11)5-8;/h3-5H2,1-2H3;1H |
| InChIKey | XFALOFIYLMISQH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|