C9H20Cl2N2O2S — CID 71758395
4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide;dihydrochloride (PubChem CID 71758395) has the molecular formula C9H20Cl2N2O2S and a molecular weight of 291.24 g/mol. Its IUPAC name is 4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide;dihydrochloride.
| Compound Name | 4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide;dihydrochloride |
|---|---|
| PubChem CID | 71758395 |
| Molecular Formula | C9H20Cl2N2O2S |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide;dihydrochloride |
| SMILES | Cl.Cl.O=S1(=O)CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C9H18N2O2S.2ClH/c12-14(13)7-5-11(6-8-14)9-1-3-10-4-2-9;;/h9-10H,1-8H2;2*1H |
| InChIKey | TUOGZOALMDFMOL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |