C25H25FN2O3 — CID 71759720
(6R,7S,8R)-4-(3-fluorobenzoyl)-8-(hydroxymethyl)-7-(4-pent-1-ynylphenyl)-1,4-diazabicyclo[4.2.0]octan-2-one (PubChem CID 71759720) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is (6R,7S,8R)-4-(3-fluorobenzoyl)-8-(hydroxymethyl)-7-(4-pent-1-ynylphenyl)-1,4-diazabicyclo[4.2.0]octan-2-one.
| Compound Name | (6R,7S,8R)-4-(3-fluorobenzoyl)-8-(hydroxymethyl)-7-(4-pent-1-ynylphenyl)-1,4-diazabicyclo[4.2.0]octan-2-one |
|---|---|
| PubChem CID | 71759720 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (6R,7S,8R)-4-(3-fluorobenzoyl)-8-(hydroxymethyl)-7-(4-pent-1-ynylphenyl)-1,4-diazabicyclo[4.2.0]octan-2-one |
| SMILES | CCCC#Cc1ccc([C@@H]2[C@H](CO)N3C(=O)CN(C(=O)c4cccc(F)c4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C25H25FN2O3/c1-2-3-4-6-17-9-11-18(12-10-17)24-21-14-27(15-23(30)28(21)22(24)16-29)25(31)19-7-5-8-20(26)13-19/h5,7-13,21-22,24,29H,2-3,14-16H2,1H3/t21-,22-,24-/m0/s1 |
| InChIKey | AVHMIGABOPQXAA-FIXSFTCYSA-N |
| XLogP | 2.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|