C6H10N4S — CID 7176013
(1,5-dimethylpyrazol-4-yl)thiourea (PubChem CID 7176013) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-4-yl)thiourea.
| Compound Name | (1,5-dimethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 7176013 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (1,5-dimethylpyrazol-4-yl)thiourea |
| SMILES | Cc1c(NC(N)=S)cnn1C |
| InChI | InChI=1S/C6H10N4S/c1-4-5(9-6(7)11)3-8-10(4)2/h3H,1-2H3,(H3,7,9,11) |
| InChIKey | IDPCSJVPBANTPJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|