C11H16N6S — CID 19326845
1-(1,5-dimethylpyrazol-4-yl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea (PubChem CID 19326845) has the molecular formula C11H16N6S and a molecular weight of 264.36 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19326845 |
| Molecular Formula | C11H16N6S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea |
| SMILES | Cc1c(NC(=S)NCc2ccnn2C)cnn1C |
| InChI | InChI=1S/C11H16N6S/c1-8-10(7-14-16(8)2)15-11(18)12-6-9-4-5-13-17(9)3/h4-5,7H,6H2,1-3H3,(H2,12,15,18) |
| InChIKey | ARAXVJCRLYSFKM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|