C8H14N4S — CID 19326815
1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]thiourea (PubChem CID 19326815) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19326815 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]thiourea |
| SMILES | CCNC(=S)NCc1ccnn1C |
| InChI | InChI=1S/C8H14N4S/c1-3-9-8(13)10-6-7-4-5-11-12(7)2/h4-5H,3,6H2,1-2H3,(H2,9,10,13) |
| InChIKey | LPNJGXGBMDVCRD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|