C7H13N5S — CID 103008072
1-amino-3-[2-(2-methylpyrazol-3-yl)ethyl]thiourea (PubChem CID 103008072) has the molecular formula C7H13N5S and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-amino-3-[2-(2-methylpyrazol-3-yl)ethyl]thiourea.
| Compound Name | 1-amino-3-[2-(2-methylpyrazol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 103008072 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 1-amino-3-[2-(2-methylpyrazol-3-yl)ethyl]thiourea |
| SMILES | Cn1nccc1CCNC(=S)NN |
| InChI | InChI=1S/C7H13N5S/c1-12-6(3-5-10-12)2-4-9-7(13)11-8/h3,5H,2,4,8H2,1H3,(H2,9,11,13) |
| InChIKey | HBFDJKCVRVHPCF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|