C13H15N5O3S — CID 17283697
1-(2-methoxy-4-nitrophenyl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea (PubChem CID 17283697) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 17283697 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)-3-[(2-methylpyrazol-3-yl)methyl]thiourea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=S)NCc1ccnn1C |
| InChI | InChI=1S/C13H15N5O3S/c1-17-10(5-6-15-17)8-14-13(22)16-11-4-3-9(18(19)20)7-12(11)21-2/h3-7H,8H2,1-2H3,(H2,14,16,22) |
| InChIKey | WQIHHTQFAYKZOB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|