C24H47N2OSn+ — CID 71762146
(E)-4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]-2-methylbut-3-en-2-ol (PubChem CID 71762146) has the molecular formula C24H47N2OSn+ and a molecular weight of 498.36 g/mol. Its IUPAC name is (E)-4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]-2-methylbut-3-en-2-ol.
| Compound Name | (E)-4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 71762146 |
| Molecular Formula | C24H47N2OSn+ |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | (E)-4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]-2-methylbut-3-en-2-ol |
| SMILES | CCCC[Sn](/C=C/C(C)(C)O)(CCCC)CCCCCC[n+]1ccn(CC)c1 |
| InChI | InChI=1S/C11H20N2.C5H9O.2C4H9.Sn/c1-3-5-6-7-8-13-10-9-12(4-2)11-13;1-4-5(2,3)6;2*1-3-4-2;/h9-11H,1,3-8H2,2H3;1,4,6H,2-3H3;2*1,3-4H2,2H3;/q+1;;;; |
| InChIKey | AQOXNBQJZRKGPZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|