C26H46BrN3Sn — CID 140799099
[4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]phenyl]methanamine bromide (PubChem CID 140799099) has the molecular formula C26H46BrN3Sn and a molecular weight of 599.29 g/mol. Its IUPAC name is [4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]phenyl]methanamine bromide.
| Compound Name | [4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]phenyl]methanamine bromide |
|---|---|
| PubChem CID | 140799099 |
| Molecular Formula | C26H46BrN3Sn |
| Molecular Weight | 599.29 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | [4-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]phenyl]methanamine bromide |
| SMILES | CCCC[Sn](CCCC)(CCCCCC[n+]1ccn(CC)c1)c1ccc(CN)cc1.[Br-] |
| InChI | InChI=1S/C11H20N2.C7H8N.2C4H9.BrH.Sn/c1-3-5-6-7-8-13-10-9-12(4-2)11-13;8-6-7-4-2-1-3-5-7;2*1-3-4-2;;/h9-11H,1,3-8H2,2H3;2-5H,6,8H2;2*1,3-4H2,2H3;1H;/q+1;;;;;/p-1 |
| InChIKey | VMCXXTCHWGFSQC-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|