C25H24N2O2 — CID 71764616
4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-3-ylmethyl)aniline (PubChem CID 71764616) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-3-ylmethyl)aniline.
| Compound Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 71764616 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-3-ylmethyl)aniline |
| SMILES | COc1cc(/C=C/c2ccc(NCc3c[nH]c4ccccc34)cc2)cc(OC)c1 |
| InChI | InChI=1S/C25H24N2O2/c1-28-22-13-19(14-23(15-22)29-2)8-7-18-9-11-21(12-10-18)26-16-20-17-27-25-6-4-3-5-24(20)25/h3-15,17,26-27H,16H2,1-2H3/b8-7+ |
| InChIKey | JZWCLQHHZNJTKV-BQYQJAHWSA-N |
| XLogP | 5.97 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|