C21H22N5O3+ — CID 7176543
N-naphthalen-1-yl-4-(3-nitropyridin-1-ium-2-yl)-1,4-diazepane-1-carboxamide (PubChem CID 7176543) has the molecular formula C21H22N5O3+ and a molecular weight of 392.44 g/mol. Its IUPAC name is N-naphthalen-1-yl-4-(3-nitropyridin-1-ium-2-yl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-naphthalen-1-yl-4-(3-nitropyridin-1-ium-2-yl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 7176543 |
| Molecular Formula | C21H22N5O3+ |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-naphthalen-1-yl-4-(3-nitropyridin-1-ium-2-yl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)N1CCCN(c2[nH+]cccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H21N5O3/c27-21(23-18-9-3-7-16-6-1-2-8-17(16)18)25-13-5-12-24(14-15-25)20-19(26(28)29)10-4-11-22-20/h1-4,6-11H,5,12-15H2,(H,23,27)/p+1 |
| InChIKey | VRKYZGHJJXYNAR-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|