C11H12F3N4O3S- — CID 7176606
2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetate (PubChem CID 7176606) has the molecular formula C11H12F3N4O3S- and a molecular weight of 337.30 g/mol. Its IUPAC name is 2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetate.
| Compound Name | 2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 7176606 |
| Molecular Formula | C11H12F3N4O3S- |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetate |
| SMILES | O=C([O-])CSCC(=O)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H13F3N4O3S/c12-11(13,14)7-1-2-16-10(18-7)17-4-3-15-8(19)5-22-6-9(20)21/h1-2H,3-6H2,(H,15,19)(H,20,21)(H,16,17,18)/p-1 |
| InChIKey | FJLAYBCKGVFHHE-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|