C20H20N4O4S — CID 71771073
CID 71771073 (PubChem CID 71771073) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol.
| Compound Name | CID 71771073 |
|---|---|
| PubChem CID | 71771073 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)Nc2cccc([S+](=O)([O-])Nc3cccnc3)c2)c1C |
| InChI | InChI=1S/C20H20N4O4S/c1-12-18(14(3)25)13(2)22-19(12)20(26)23-15-6-4-8-17(10-15)29(27,28)24-16-7-5-9-21-11-16/h4-11H,1-3H3,(H3-,22,23,24,25,26,27,28) |
| InChIKey | URNWMAJJDMHFMY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|