About CID 71771067
CID 71771067 (PubChem CID 71771067) has the molecular formula C24H24N4O4S
and a molecular weight of 464.55 g/mol.
Molecular Properties
| Compound Name | CID 71771067 |
| PubChem CID | 71771067 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | — |
| SMILES | CCc1ccc(NC(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1[S+](=O)([O-])Nc1ccccc1C#N |
| InChI | InChI=1S/C24H24N4O4S/c1-5-17-10-11-19(27-24(30)23-14(2)22(16(4)29)15(3)26-23)12-21(17)33(31,32)28-20-9-7-6-8-18(20)13-25/h6-12H,5H2,1-4H3,(H3-,26,27,28,29,30,31,32) |
| InChIKey | YOXLJQSIWQLZDK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 71771067 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71771067?
The IUPAC name of CID 71771067 (CID 71771067) is not available.
What is the SMILES notation for CID 71771067?
The canonical SMILES for CID 71771067 is CCc1ccc(NC(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1[S+](=O)([O-])Nc1ccccc1C#N.
What is the InChIKey of CID 71771067?
The InChIKey is YOXLJQSIWQLZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O4S/c1-5-17-10-11-19(27-24(30)23-14(2)22(16(4)29)15(3)26-23)12-21(17)33(31,32)28-20-9-7-6-8-18(20)13-25/h6-12H,5H2,1-4H3,(H3-,26,27,28,29,30,31,32).
What are the key properties of CID 71771067?
CID 71771067 has a molecular weight of 464.55 g/mol, XLogP of 4.54, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71771067 is sourced from PubChem (CID 71771067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).