C24H24N4O4S — CID 71771067
CID 71771067 (PubChem CID 71771067) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol.
| Compound Name | CID 71771067 |
|---|---|
| PubChem CID | 71771067 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | — |
| SMILES | CCc1ccc(NC(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1[S+](=O)([O-])Nc1ccccc1C#N |
| InChI | InChI=1S/C24H24N4O4S/c1-5-17-10-11-19(27-24(30)23-14(2)22(16(4)29)15(3)26-23)12-21(17)33(31,32)28-20-9-7-6-8-18(20)13-25/h6-12H,5H2,1-4H3,(H3-,26,27,28,29,30,31,32) |
| InChIKey | YOXLJQSIWQLZDK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|