C24H23NO5 — CID 7177618
methyl (4R,7R)-4-(2,3-dihydro-1-benzofuran-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7177618) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl (4R,7R)-4-(2,3-dihydro-1-benzofuran-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | methyl (4R,7R)-4-(2,3-dihydro-1-benzofuran-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7177618 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl (4R,7R)-4-(2,3-dihydro-1-benzofuran-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccco3)C2)[C@H]1c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C24H23NO5/c1-13-21(24(27)28-2)22(15-5-6-20-14(10-15)7-9-30-20)23-17(25-13)11-16(12-18(23)26)19-4-3-8-29-19/h3-6,8,10,16,21-22H,7,9,11-12H2,1-2H3/t16-,21?,22+/m1/s1 |
| InChIKey | QCLOJXUIJYTXEI-OBLXYAIXSA-N |
| XLogP | 3.96 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |