C23H21NO6 — CID 7177576
methyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7177576) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is methyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | methyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7177576 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC2=C(C(=O)C[C@@H](c3ccco3)C2)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H21NO6/c1-12-20(23(26)27-2)21(13-5-6-18-19(10-13)30-11-29-18)22-15(24-12)8-14(9-16(22)25)17-4-3-7-28-17/h3-7,10,14,20-21H,8-9,11H2,1-2H3/t14-,20?,21-/m0/s1 |
| InChIKey | DYWAFESQQRMTHQ-YZIZEKMBSA-N |
| XLogP | 3.76 |
| TPSA | 87.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |